EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H27O4PSi3 |
| Net Charge | 0 |
| Average Mass | 314.543 |
| Monoisotopic Mass | 314.09548 |
| SMILES | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C9H27O4PSi3/c1-15(2,3)11-14(10,12-16(4,5)6)13-17(7,8)9/h1-9H3 |
| InChIKey | QJMMCGKXBZVAEI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | umbilical vein endothelial cell line (BTO:0001520) | MetaboLights (MTBLS739) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tris(trimethylsilyl) phosphate (CHEBI:144345) is a organosilicon compound (CHEBI:25713) |
| tris(trimethylsilyl) phosphate (CHEBI:144345) is a phosphoric acid derivative (CHEBI:26079) |
| IUPAC Name |
|---|
| tris(trimethylsilyl) phosphate |
| Synonyms | Source |
|---|---|
| phosphoric acid tris(trimethylsilyl ester) | ChEBI |
| phosphoric acid tris(trimethylsilyl) ester | ChemIDplus |
| silanol, 1,1,1-trimethyl-, 1,1',1''-phosphate | ChemIDplus |
| silanol, trimethyl-, phosphate (3:1) | ChEBI |
| tris(trimethylsiloxy)phosphine oxide | ChEBI |
| tris(trimethylsilyl) ester of phosphoric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 23649 | ChemSpider |
| CN101870711 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1794624 | Reaxys |
| CAS:10497-05-9 | ChemIDplus |
| CAS:10497-05-9 | NIST Chemistry WebBook |
| Citations |
|---|