EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13N3 |
| Net Charge | 0 |
| Average Mass | 211.268 |
| Monoisotopic Mass | 211.11095 |
| SMILES | N=C(Nc1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C13H13N3/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-10H,(H3,14,15,16) |
| InChIKey | OWRCNXZUPFZXOS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3-diphenylguanidine (CHEBI:144319) has role allergen (CHEBI:50904) |
| 1,3-diphenylguanidine (CHEBI:144319) is a guanidines (CHEBI:24436) |
| Incoming Relation(s) |
| carba mix (CHEBI:144357) has part 1,3-diphenylguanidine (CHEBI:144319) |
| IUPAC Name |
|---|
| N,N'-diphenylguanidine |
| Synonyms | Source |
|---|---|
| 1,3-Diphenylguanidine | ChemIDplus |
| s-Diphenylguanidine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:102-06-7 | ChemIDplus |
| Citations |
|---|