EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:144241 - divarinol
| Formula | C9H12O2 |
| Net Charge | 0 |
| Average Mass | 152.193 |
| Monoisotopic Mass | 152.08373 |
| SMILES | CCCc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C9H12O2/c1-2-3-7-4-8(10)6-9(11)5-7/h4-6,10-11H,2-3H2,1H3 |
| InChIKey | FRNQLQRBNSSJBK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Protousnea poeppigii (ncbitaxon:235511) | - | PubMed (18058986) | |
| Crematogaster difformis (ncbitaxon:1898293) | - | PubMed (24271446) | Detected in the secretion of the hypertrophied metapleural gland. |
| Dirinaria applanata (ncbitaxon:205617) | - | PubMed (31339381) |
| Roles Classification |
|---|
| Biological Roles: | semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. lichen metabolite Any metabolite that is produced during a metabolite reaction in lichens (composite organisms consisting of a fungus and a photosynthetic partner co-existing in a symbiotic relationship). animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| divarinol (CHEBI:144241) has role animal metabolite (CHEBI:75767) |
| divarinol (CHEBI:144241) has role fungal metabolite (CHEBI:76946) |
| divarinol (CHEBI:144241) has role lichen metabolite (CHEBI:78361) |
| divarinol (CHEBI:144241) has role semiochemical (CHEBI:26645) |
| divarinol (CHEBI:144241) is a 5-alkylresorcinol (CHEBI:52679) |
| IUPAC Name |
|---|
| 5-propylbenzene-1,3-diol |
| Synonyms | Source |
|---|---|
| 5-propyl-1,3-benzenediol | ChEBI |
| 1,3-dihydroxy-5-propylbenzene | ChEBI |
| 5-propylresorcinol | ChEBI |
| divarin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:500-49-2 | ChemIDplus |
| Citations |
|---|