EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12O4 |
| Net Charge | 0 |
| Average Mass | 292.290 |
| Monoisotopic Mass | 292.07356 |
| SMILES | O=C1C(O)=C(c2ccccc2)C(=O)C(O)=C1c1ccccc1 |
| InChI | InChI=1S/C18H12O4/c19-15-13(11-7-3-1-4-8-11)16(20)18(22)14(17(15)21)12-9-5-2-6-10-12/h1-10,19,22H |
| InChIKey | HZKFHDXTSAYOSN-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Polyporic acid (CHEBI:144197) is a p-quinones (CHEBI:25830) |
| Polyporic acid (CHEBI:144197) is a benzoquinones (CHEBI:22729) |
| Polyporic acid (CHEBI:144197) is conjugate acid of polyporic acid anion(1−) (CHEBI:192516) |
| Incoming Relation(s) |
| polyporic acid anion(1−) (CHEBI:192516) is conjugate base of Polyporic acid (CHEBI:144197) |