EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15ClO6 |
| Net Charge | 0 |
| Average Mass | 362.765 |
| Monoisotopic Mass | 362.05572 |
| SMILES | [H]C(=O)c1c(O)c(Cl)c(C)c2c1Oc1c(C)cc(OC)c(C)c1OC2=O |
| InChI | InChI=1S/C18H15ClO6/c1-7-5-11(23-4)8(2)16-15(7)24-17-10(6-20)14(21)13(19)9(3)12(17)18(22)25-16/h5-6,21H,1-4H3 |
| InChIKey | LVGKNESDSKGROR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sphaerophorus globosus (ncbitaxon:40600) | - | PubMed (18721817) | |
| Psoroma (ncbitaxon:176449) | - | DOI (/10.1021/np50041a036) | Isolated from several Psoroma species including dimorphum, pallidum, pulchrum and reticulatum. |
| Roles Classification |
|---|
| Biological Roles: | lichen metabolite Any metabolite that is produced during a metabolite reaction in lichens (composite organisms consisting of a fungus and a photosynthetic partner co-existing in a symbiotic relationship). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pannarin (CHEBI:144185) has role antimicrobial agent (CHEBI:33281) |
| pannarin (CHEBI:144185) has role antineoplastic agent (CHEBI:35610) |
| pannarin (CHEBI:144185) has role apoptosis inducer (CHEBI:68495) |
| pannarin (CHEBI:144185) has role lichen metabolite (CHEBI:78361) |
| pannarin (CHEBI:144185) is a aldehyde (CHEBI:17478) |
| pannarin (CHEBI:144185) is a aromatic ether (CHEBI:35618) |
| pannarin (CHEBI:144185) is a depsidones (CHEBI:75939) |
| pannarin (CHEBI:144185) is a organic heterotricyclic compound (CHEBI:26979) |
| pannarin (CHEBI:144185) is a organochlorine compound (CHEBI:36683) |
| pannarin (CHEBI:144185) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-chloro-3-hydroxy-8-methoxy-1,6,9-trimethyl-11-oxo-11H-dibenzo[b,e][1,4]dioxepine-4-carbaldehyde |
| Synonym | Source |
|---|---|
| pannarine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:55609-84-2 | ChemIDplus |
| Citations |
|---|