EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15ClO6 |
| Net Charge | 0 |
| Average Mass | 362.765 |
| Monoisotopic Mass | 362.05572 |
| SMILES | [H]C(=O)c1c(O)c(Cl)c(C)c2c1Oc1c(C)cc(OC)c(C)c1OC2=O |
| InChI | InChI=1S/C18H15ClO6/c1-7-5-11(23-4)8(2)16-15(7)24-17-10(6-20)14(21)13(19)9(3)12(17)18(22)25-16/h5-6,21H,1-4H3 |
| InChIKey | LVGKNESDSKGROR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Psoroma (ncbitaxon:176449) | - | DOI (/10.1021/np50041a036) | Isolated from several Psoroma species including dimorphum, pallidum, pulchrum and reticulatum. |
| Sphaerophorus globosus (ncbitaxon:40600) | - | PubMed (18721817) |
| Roles Classification |
|---|
| Biological Roles: | lichen metabolite Any metabolite that is produced during a metabolite reaction in lichens (composite organisms consisting of a fungus and a photosynthetic partner co-existing in a symbiotic relationship). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pannarin (CHEBI:144185) has role antimicrobial agent (CHEBI:33281) |
| pannarin (CHEBI:144185) has role antineoplastic agent (CHEBI:35610) |
| pannarin (CHEBI:144185) has role apoptosis inducer (CHEBI:68495) |
| pannarin (CHEBI:144185) has role lichen metabolite (CHEBI:78361) |
| pannarin (CHEBI:144185) is a aldehyde (CHEBI:17478) |
| pannarin (CHEBI:144185) is a aromatic ether (CHEBI:35618) |
| pannarin (CHEBI:144185) is a depsidones (CHEBI:75939) |
| pannarin (CHEBI:144185) is a organic heterotricyclic compound (CHEBI:26979) |
| pannarin (CHEBI:144185) is a organochlorine compound (CHEBI:36683) |
| pannarin (CHEBI:144185) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-chloro-3-hydroxy-8-methoxy-1,6,9-trimethyl-11-oxo-11H-dibenzo[b,e][1,4]dioxepine-4-carbaldehyde |
| Synonym | Source |
|---|---|
| pannarine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:55609-84-2 | ChemIDplus |
| Citations |
|---|