EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H54O4 |
| Net Charge | 0 |
| Average Mass | 502.780 |
| Monoisotopic Mass | 502.40221 |
| SMILES | CC(=O)OC(C)(C)[C@H]1CC[C@@](C)([C@H]2CC[C@]3(C)[C@@H]2CC[C@@H]2[C@@]4(C)CC[C@H](O)C(C)(C)C4CC[C@]23C)O1 |
| InChI | InChI=1S/C32H54O4/c1-20(33)35-28(4,5)26-15-19-32(9,36-26)22-12-17-30(7)21(22)10-11-24-29(6)16-14-25(34)27(2,3)23(29)13-18-31(24,30)8/h21-26,34H,10-19H2,1-9H3/t21-,22+,23?,24-,25+,26-,29+,30-,31-,32+/m1/s1 |
| InChIKey | KLFGJICTDRFLDB-VJNLAODGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 25-Acetoxy-3b-hydroxy-20(S),24(R)-epoxydammarane (CHEBI:144137) is a triterpenoid saponin (CHEBI:61778) |