EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H13BrN4O2 |
| Net Charge | 0 |
| Average Mass | 421.254 |
| Monoisotopic Mass | 420.02219 |
| SMILES | O=C(c1ncc(-c2cnc3cc(Br)ccc23)n1)c1cnc2cc(O)ccc12 |
| InChI | InChI=1S/C20H13BrN4O2/c21-10-1-3-12-14(7-22-16(12)5-10)18-9-24-20(25-18)19(27)15-8-23-17-6-11(26)2-4-13(15)17/h1-9,22-23,26H,(H,24,25) |
| InChIKey | YHGQVXFIJGWOFP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Halichondriidae (ncbitaxon:6060) | - | Article (J. Org. Chem.1988, v53(23), 5446-5453) | |
| Topsentia genitrix (WORMS:157419) | - | Article (Can. J. Chem, 1987, V68, 2118) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromotopsentin (CHEBI:144088) has role antineoplastic agent (CHEBI:35610) |
| bromotopsentin (CHEBI:144088) has role antiviral agent (CHEBI:22587) |
| bromotopsentin (CHEBI:144088) has role marine metabolite (CHEBI:76507) |
| bromotopsentin (CHEBI:144088) is a aromatic ketone (CHEBI:76224) |
| bromotopsentin (CHEBI:144088) is a bromoindole (CHEBI:52514) |
| bromotopsentin (CHEBI:144088) is a hydroxyindoles (CHEBI:84729) |
| bromotopsentin (CHEBI:144088) is a imidazoles (CHEBI:24780) |
| bromotopsentin (CHEBI:144088) is a indole alkaloid (CHEBI:38958) |
| IUPAC Name |
|---|
| [4-(6-bromo-1H-indol-3-yl)-1H-imidazol-2-yl](6-hydroxy-1H-indol-3-yl)methanone |
| Synonym | Source |
|---|---|
| Topsentin B 2 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:112515-44-3 | ChemIDplus |
| Citations |
|---|