EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15BrN4O |
| Net Charge | 0 |
| Average Mass | 407.271 |
| Monoisotopic Mass | 406.04292 |
| SMILES | O=C(C1=N[C@@H](c2cnc3cc(Br)ccc23)CN1)c1cnc2ccccc12 |
| InChI | InChI=1S/C20H15BrN4O/c21-11-5-6-13-14(8-23-17(13)7-11)18-10-24-20(25-18)19(26)15-9-22-16-4-2-1-3-12(15)16/h1-9,18,22-23H,10H2,(H,24,25)/t18-/m1/s1 |
| InChIKey | BYNAFSYAUGRDSZ-GOSISDBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spongosorites (ncbitaxon:6070) | - | DOI (10.1021/np060206z) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spongotine A (CHEBI:144086) has role antineoplastic agent (CHEBI:35610) |
| spongotine A (CHEBI:144086) has role marine metabolite (CHEBI:76507) |
| spongotine A (CHEBI:144086) is a aromatic ketone (CHEBI:76224) |
| spongotine A (CHEBI:144086) is a bisindole alkaloid (CHEBI:51879) |
| spongotine A (CHEBI:144086) is a bromoindole (CHEBI:52514) |
| spongotine A (CHEBI:144086) is a imidazolines (CHEBI:53095) |
| IUPAC Name |
|---|
| [(4S)-4-(6-bromo-1H-indol-3-yl)-4,5-dihydro-1H-imidazol-2-yl](1H-indol-3-yl)methanone |
| Synonyms | Source |
|---|---|
| 4,5-dihydro-6'-deoxybromotopsentin | ChEBI |
| (−)-spongotine A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00040357 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:116747-40-1 | KNApSAcK |
| Citations |
|---|