EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12Cl2O5 |
| Net Charge | 0 |
| Average Mass | 355.173 |
| Monoisotopic Mass | 354.00618 |
| SMILES | COc1cc(C)c2c(=O)c3c(O)c(Cl)c(OC)c(Cl)c3oc2c1 |
| InChI | InChI=1S/C16H12Cl2O5/c1-6-4-7(21-2)5-8-9(6)13(19)10-14(20)11(17)16(22-3)12(18)15(10)23-8/h4-5,20H,1-3H3 |
| InChIKey | ZPLILIOXZHNNLY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pertusaria (ncbitaxon:50932) | - | Article (Book: Dictionary of Natural Products, Supplement 1, page 91) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dichlorolichexanthone (CHEBI:144076) has role fungal metabolite (CHEBI:76946) |
| 2,4-dichlorolichexanthone (CHEBI:144076) is a aromatic ether (CHEBI:35618) |
| 2,4-dichlorolichexanthone (CHEBI:144076) is a organochlorine compound (CHEBI:36683) |
| 2,4-dichlorolichexanthone (CHEBI:144076) is a polyphenol (CHEBI:26195) |
| 2,4-dichlorolichexanthone (CHEBI:144076) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 2,4-dichloro-1-hydroxy-3,6-dimethoxy-8-methyl-9H-xanthen-9-one |
| Synonyms | Source |
|---|---|
| 2,4-dichloro-3,6-di-O-methylnorlichexanthone | SUBMITTER |
| 2,4-dichloro-1-hydroxy-3,6-dimethoxy-8-methylxanthone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:22105-97-1 | ChEBI |