EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H7Cl3O5 |
| Net Charge | 0 |
| Average Mass | 361.564 |
| Monoisotopic Mass | 359.93591 |
| SMILES | Cc1cc(O)c(Cl)c2oc3c(Cl)c(O)c(Cl)c(O)c3c(=O)c12 |
| InChI | InChI=1S/C14H7Cl3O5/c1-3-2-4(18)7(15)13-5(3)10(19)6-11(20)8(16)12(21)9(17)14(6)22-13/h2,18,20-21H,1H3 |
| InChIKey | NTAXLEHKEDVPRK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lecanora iseana (ncbitaxon:39934) | - | PubMed (15771887) |
| Roles Classification |
|---|
| Biological Role: | lichen metabolite Any metabolite that is produced during a metabolite reaction in lichens (composite organisms consisting of a fungus and a photosynthetic partner co-existing in a symbiotic relationship). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arthothelin (CHEBI:144075) has role lichen metabolite (CHEBI:78361) |
| arthothelin (CHEBI:144075) is a organochlorine compound (CHEBI:36683) |
| arthothelin (CHEBI:144075) is a polyphenol (CHEBI:26195) |
| arthothelin (CHEBI:144075) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 2,4,5-trichloro-1,3,6-trihydroxy-8-methyl-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| 2,4,5-trichloronorlichexanthone | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| C00035246 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:20716-96-5 | KNApSAcK |
| CAS:20716-96-5 | ChemIDplus |
| Citations |
|---|