EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30O9 |
| Net Charge | 0 |
| Average Mass | 474.506 |
| Monoisotopic Mass | 474.18898 |
| SMILES | CCCCCc1c(Oc2cc(OC)cc3c2C(=O)OC3(O)CCCC)c(O)cc(O)c1C(=O)O |
| InChI | InChI=1S/C25H30O9/c1-4-6-8-9-15-20(23(28)29)17(26)13-18(27)22(15)33-19-12-14(32-3)11-16-21(19)24(30)34-25(16,31)10-7-5-2/h11-13,26-27,31H,4-10H2,1-3H3,(H,28,29) |
| InChIKey | BWRBGHBJBQFFAW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stereocaulon halei (ncbitaxon:50938) | - | PubMed (23041521) |
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | lichen metabolite Any metabolite that is produced during a metabolite reaction in lichens (composite organisms consisting of a fungus and a photosynthetic partner co-existing in a symbiotic relationship). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lobarin (CHEBI:144069) has role lichen metabolite (CHEBI:78361) |
| lobarin (CHEBI:144069) has role radical scavenger (CHEBI:48578) |
| lobarin (CHEBI:144069) is a 2-benzofurans (CHEBI:38831) |
| lobarin (CHEBI:144069) is a aromatic ether (CHEBI:35618) |
| lobarin (CHEBI:144069) is a benzoic acids (CHEBI:22723) |
| lobarin (CHEBI:144069) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3-[(1-butyl-1-hydroxy-6-methoxy-3-oxo-1,3-dihydro-2-benzofuran-4-yl)oxy]-4,6-dihydroxy-2-pentylbenzoic acid |
| Synonym | Source |
|---|---|
| lobariol carboxylic acid | SUBMITTER |
| Citations |
|---|