EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8N2O2 |
| Net Charge | 0 |
| Average Mass | 128.131 |
| Monoisotopic Mass | 128.05858 |
| SMILES | CC1NC(=O)CNC1=O |
| InChI | InChI=1S/C5H8N2O2/c1-3-5(9)6-2-4(8)7-3/h3H,2H2,1H3,(H,6,9)(H,7,8) |
| InChIKey | ICCHEGCKVBMSTF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium sp. (ncbitaxon:5081) | - | PubMed (24144081) | Strain: YY-20 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylpiperazine-2,5-dione (CHEBI:144050) has role Penicillium metabolite (CHEBI:76964) |
| 3-methylpiperazine-2,5-dione (CHEBI:144050) is a 2,5-diketopiperazines (CHEBI:65061) |
| IUPAC Name |
|---|
| 3-methylpiperazine-2,5-dione |
| Synonyms | Source |
|---|---|
| 3-methyl-2,5-dioxopiperazine | ChEBI |
| 3-methyl-2,5-piperazinedione | ChEBI |
| alanylglycine anhydride | ChEBI |
| cyclo(ala-gly) | ChemIDplus |
| cyclo(alanyl-glycyl) | ChemIDplus |
| cyclo(alanylglycyl) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| FDB008158 | FooDB |
| HMDB0031547 | HMDB |
| Citations |
|---|