EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | O=C(O)[C@]1(O)CCCN1 |
| InChI | InChI=1S/C5H9NO3/c7-4(8)5(9)2-1-3-6-5/h6,9H,1-3H2,(H,7,8)/t5-/m1/s1 |
| InChIKey | JNKCXIWJIVUIMN-RXMQYKEDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-L-proline (CHEBI:144030) is a hydroxyproline (CHEBI:24741) |
| Incoming Relation(s) |
| 2-hydroxy-L-proline residue (CHEBI:141809) is substituent group from 2-hydroxy-L-proline (CHEBI:144030) |
| Synonyms | Source |
|---|---|
| (2R)-2-hydroxypyrrolidine-2-carboxylic acid | ChEBI |
| α-hydroxyproline | ChEBI |
| 2-hydroxyproline | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| PXU | PDBeChem |
| Citations |
|---|