EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O5 |
| Net Charge | 0 |
| Average Mass | 232.236 |
| Monoisotopic Mass | 232.10592 |
| SMILES | CC[C@H](N)C(=O)OC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H16N2O5/c1-2-5(10)9(15)16-7(12)4-3-6(11)8(13)14/h5-6H,2-4,10-11H2,1H3,(H,13,14)/t5-,6-/m0/s1 |
| InChIKey | AKRSAXOGLJEIEZ-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gamma-L-glutamyl-L-alpha-aminobutyrate (CHEBI:144027) is a amino acid (CHEBI:33709) |