EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10NO5P |
| Net Charge | 0 |
| Average Mass | 183.100 |
| Monoisotopic Mass | 183.02966 |
| SMILES | N[C@@H](CCP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C4H10NO5P/c5-3(4(6)7)1-2-11(8,9)10/h3H,1-2,5H2,(H,6,7)(H2,8,9,10)/t3-/m0/s1 |
| InChIKey | DDOQBQRIEWHWBT-VKHMYHEASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabotropic glutamate receptor agonist An agonist that selectively binds to and activates a metabotropic glutamate receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-amino-4-phosphonobutanoic acid (CHEBI:143992) has role metabotropic glutamate receptor agonist (CHEBI:61966) |
| (2S)-2-amino-4-phosphonobutanoic acid (CHEBI:143992) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| (2S)-2-amino-4-phosphonobutanoic acid (CHEBI:143992) is a phosphonic acids (CHEBI:26069) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-phosphonobutanoic acid |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-4-phosphonobutyric acid | IUPAC |
| (S)-2-amino-4-phosphonobutanoic acid | ChEBI |
| (S)-2-amino-4-phosphonobutyric acid | SUBMITTER |
| L-AP-4 | ChEBI |
| L-(+)-2-amino-4-phosphonobutanoic acid | ChEBI |
| L-(+)-2-amino-4-phosphonobutyric acid | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| L-AP4 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:23052-81-5 | ChemIDplus |
| Citations |
|---|