EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C9H18N3O3 |
| Net Charge | 0 |
| Average Mass | 217.269 |
| Monoisotopic Mass | 217.14264 |
| SMILES | NCCCC[C@H](NC(=O)CCN)C(=O)[O-].[H+] |
| InChI | InChI=1S/C9H19N3O3/c10-5-2-1-3-7(9(14)15)12-8(13)4-6-11/h7H,1-6,10-11H2,(H,12,13)(H,14,15)/t7-/m0/s1 |
| InChIKey | PLDCWKCPEXNWJH-ZETCQYMHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-alanyl-L-lysine zwitterion (CHEBI:143903) is a dipeptide zwitterion (CHEBI:90799) |
| β-alanyl-L-lysine zwitterion (CHEBI:143903) is conjugate base of β-alanyl-L-lysinium (CHEBI:143161) |
| β-alanyl-L-lysine zwitterion (CHEBI:143903) is tautomer of β-alanyl-L-lysine (CHEBI:27749) |
| Incoming Relation(s) |
| β-alanyl-L-lysinium (CHEBI:143161) is conjugate acid of β-alanyl-L-lysine zwitterion (CHEBI:143903) |
| β-alanyl-L-lysine (CHEBI:27749) is tautomer of β-alanyl-L-lysine zwitterion (CHEBI:143903) |