EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24FN5O |
| Net Charge | 0 |
| Average Mass | 333.411 |
| Monoisotopic Mass | 333.19649 |
| SMILES | Cc1cc(C)cc(OC[C@H](C)Nc2nc(N)nc(C(C)(C)F)n2)c1 |
| InChI | InChI=1S/C17H24FN5O/c1-10-6-11(2)8-13(7-10)24-9-12(3)20-16-22-14(17(4,5)18)21-15(19)23-16/h6-8,12H,9H2,1-5H3,(H3,19,20,21,22,23)/t12-/m0/s1 |
| InChIKey | IUFUITYPUYMIHI-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-triaziflam (CHEBI:143896) is a N-[1-(3,5-dimethylphenoxy)propan-2-yl]-6-(2-fluoropropan-2-yl)-1,3,5-triazine-2,4-diamine (CHEBI:143897) |
| (S)-triaziflam (CHEBI:143896) is enantiomer of (R)-triaziflam (CHEBI:143895) |
| Incoming Relation(s) |
| triaziflam (CHEBI:143894) has part (S)-triaziflam (CHEBI:143896) |
| (R)-triaziflam (CHEBI:143895) is enantiomer of (S)-triaziflam (CHEBI:143896) |
| IUPAC Names |
|---|
| N-[(2S)-1-(3,5-dimethylphenoxy)propan-2-yl]-6-(2-fluoropropan-2-yl)-1,3,5-triazine-2,4-diamine |
| N2-[(2S)-1-(3,5-dimethylphenoxy)propan-2-yl]-6-(2-fluoropropan-2-yl)-1,3,5-triazine-2,4-diamine |
| Citations |
|---|