EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O4 |
| Net Charge | 0 |
| Average Mass | 236.267 |
| Monoisotopic Mass | 236.10486 |
| SMILES | [H]C(=O)c1ccc(OC(=O)C(C)C)c(OCC)c1 |
| InChI | InChI=1S/C13H16O4/c1-4-16-12-7-10(8-14)5-6-11(12)17-13(15)9(2)3/h5-9H,4H2,1-3H3 |
| InChIKey | BTCQMCOBMIXUCG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl vanillin isobutyrate (CHEBI:143870) has role flavouring agent (CHEBI:35617) |
| ethyl vanillin isobutyrate (CHEBI:143870) is a aromatic ether (CHEBI:35618) |
| ethyl vanillin isobutyrate (CHEBI:143870) is a benzaldehydes (CHEBI:22698) |
| ethyl vanillin isobutyrate (CHEBI:143870) is a carboxylic ester (CHEBI:33308) |
| IUPAC Name |
|---|
| 2-ethoxy-4-formylphenyl 2-methylpropanoate |
| Synonyms | Source |
|---|---|
| 2-ethoxy-4-formylphenyl isobutyrate | ChemIDplus |
| 2-methylpropanoic acid 2-ethoxy-4-formylphenyl ester | ChEBI |
| 4-isobutanoyloxy-3-ethoxybenzaldehyde | ChemIDplus |
| ethyl vanillin isobutyrate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| FDB016810 | FooDB |
| HMDB0037683 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:188417-26-7 | ChemIDplus |