EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26O5 |
| Net Charge | 0 |
| Average Mass | 394.467 |
| Monoisotopic Mass | 394.17802 |
| SMILES | CC(C)=CCc1ccc2oc3c(C)c(O)c(CC=C(C)C)c(O)c3c(=O)c2c1O |
| InChI | InChI=1S/C24H26O5/c1-12(2)6-8-15-9-11-17-18(21(15)26)23(28)19-22(27)16(10-7-13(3)4)20(25)14(5)24(19)29-17/h6-7,9,11,25-27H,8,10H2,1-5H3 |
| InChIKey | QPSZSDVSMAQDTD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia mangostana (ncbitaxon:58228) | - | Article (Book: Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. CRC press.) | Constituent of the fruit hulls. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,8-trihydroxy-4-methyl-2,7-diprenylxanthone (CHEBI:143868) has role plant metabolite (CHEBI:76924) |
| 1,3,8-trihydroxy-4-methyl-2,7-diprenylxanthone (CHEBI:143868) is a polyphenol (CHEBI:26195) |
| 1,3,8-trihydroxy-4-methyl-2,7-diprenylxanthone (CHEBI:143868) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,3,8-trihydroxy-4-methyl-2,7-bis(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| Synonyms | Source |
|---|---|
| 1,3,8-trihydroxy-4-methyl-2,7-bis(3-methyl-2-buten-1-yl)-9H-xanthen-9-one | ChEBI |
| 1,3,8-trihydroxy-4-methyl-2,7-bis(3-methyl-2-butenyl)-9H-xanthen-9-one | ChEBI |
| 1,3,8-trihydroxy-4-methyl-2,7-bis(3-methylbut-2-en-1-yl)xanthen-9-one | HMDB |
| Manual Xrefs | Databases |
|---|---|
| FDB016317 | FooDB |
| HMDB0037298 | HMDB |