EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18ClF3N2O6 |
| Net Charge | 0 |
| Average Mass | 474.819 |
| Monoisotopic Mass | 474.08055 |
| SMILES | C=CCOC(=O)C(C)(C)OC(=O)c1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)ccc1Cl |
| InChI | InChI=1S/C20H18ClF3N2O6/c1-5-8-31-17(29)19(2,3)32-16(28)12-9-11(6-7-13(12)21)26-15(27)10-14(20(22,23)24)25(4)18(26)30/h5-7,9-10H,1,8H2,2-4H3 |
| InChIKey | JEDYYFXHPAIBGR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butafenacil (CHEBI:143863) has functional parent uracil (CHEBI:17568) |
| butafenacil (CHEBI:143863) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| butafenacil (CHEBI:143863) has role herbicide (CHEBI:24527) |
| butafenacil (CHEBI:143863) is a benzoate ester (CHEBI:36054) |
| butafenacil (CHEBI:143863) is a diester (CHEBI:51307) |
| butafenacil (CHEBI:143863) is a monochlorobenzenes (CHEBI:83403) |
| butafenacil (CHEBI:143863) is a olefinic compound (CHEBI:78840) |
| butafenacil (CHEBI:143863) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 2-methyl-1-oxo-1-[(prop-2-en-1-yl)oxy]propan-2-yl 2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-3,6-dihydropyrimidin-1(2H)-yl]benzoate |
| Synonyms | Source |
|---|---|
| 1,1-dimethyl-2-oxo-2-(2-propen-1-yloxy)ethyl 2-chloro-5-[3,6-dihydro-3-methyl-2,6-dioxo-4-(trifluoromethyl)-1(2H)-pyrimidinyl]benzoate | Alan Wood's Pesticides |
| 1-(allyloxycarbonyl)-1-methylethyl 2-chloro-5-[1,2,3,6-tetrahydro-3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate | Alan Wood's Pesticides |
| CGA 276854 | PPDB |
| CGA-276854 | ChEBI |
| Brand Names | Source |
|---|---|
| B-Power | ChEBI |
| Logran B-Power | ChEBI |
| Touchdown B-Power | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1163 | PPDB |
| butafenacil | Alan Wood's Pesticides |
| DB15261 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11322304 | Reaxys |
| CAS:134605-64-4 | Alan Wood's Pesticides |
| Citations |
|---|