EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22O |
| Net Charge | 0 |
| Average Mass | 206.329 |
| Monoisotopic Mass | 206.16707 |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(O)c1 |
| InChI | InChI=1S/C14H22O/c1-13(2,3)10-7-8-11(12(15)9-10)14(4,5)6/h7-9,15H,1-6H3 |
| InChIKey | KDBZVULQVCUNNA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | - | PubMed (26761505) | Isolated from the veal of Holstein bull calves. |
| Labisia pumila var. lanceolata (ncbitaxon:410778) | leaf (BTO:0000713) | PubMed (21829154) |
| Roles Classification |
|---|
| Biological Roles: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-di-tert-butylphenol (CHEBI:143859) has role mammalian metabolite (CHEBI:75768) |
| 2,5-di-tert-butylphenol (CHEBI:143859) has role plant metabolite (CHEBI:76924) |
| 2,5-di-tert-butylphenol (CHEBI:143859) is a alkylbenzene (CHEBI:38976) |
| 2,5-di-tert-butylphenol (CHEBI:143859) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2,5-di-tert-butylphenol |
| Synonym | Source |
|---|---|
| 2,5-bis(1,1-dimethylethyl)phenol | ChemIDplus |
| Citations |
|---|