EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:143858 - decane-1,2-diol
| Formula | C10H22O2 |
| Net Charge | 0 |
| Average Mass | 174.284 |
| Monoisotopic Mass | 174.16198 |
| SMILES | CCCCCCCCC(O)CO |
| InChI | InChI=1S/C10H22O2/c1-2-3-4-5-6-7-8-10(12)9-11/h10-12H,2-9H2,1H3 |
| InChIKey | YSRSBDQINUMTIF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | PubMed (30531924) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| decane-1,2-diol (CHEBI:143858) has parent hydride decane (CHEBI:41808) |
| decane-1,2-diol (CHEBI:143858) has role anti-inflammatory agent (CHEBI:67079) |
| decane-1,2-diol (CHEBI:143858) has role antioxidant (CHEBI:22586) |
| decane-1,2-diol (CHEBI:143858) has role human metabolite (CHEBI:77746) |
| decane-1,2-diol (CHEBI:143858) is a glycol (CHEBI:13643) |
| decane-1,2-diol (CHEBI:143858) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| decane-1,2-diol |
| Synonyms | Source |
|---|---|
| decylene glycol | ChemIDplus |
| 1,2-decanediol | NIST Chemistry WebBook |
| 1,2-dihydroxydecane | ChEBI |
| Citations |
|---|