EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12 |
| Net Charge | 0 |
| Average Mass | 132.206 |
| Monoisotopic Mass | 132.09390 |
| SMILES | C=Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C10H12/c1-4-10-6-5-8(2)9(3)7-10/h4-7H,1H2,2-3H3 |
| InChIKey | PMZXJPLGCUVUDN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Boswellia ameero (ncbitaxon:613103) | - | PubMed (28930202) | |
| Fortunella crassifolia (IPNI:773636-1) | - | PubMed (22489157) | Isolated from peel. |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-ethenyl-1,2-dimethylbenzene (CHEBI:143854) has role plant metabolite (CHEBI:76924) |
| 4-ethenyl-1,2-dimethylbenzene (CHEBI:143854) has role volatile oil component (CHEBI:27311) |
| 4-ethenyl-1,2-dimethylbenzene (CHEBI:143854) is a styrenes (CHEBI:26799) |
| IUPAC Name |
|---|
| 4-ethenyl-1,2-dimethylbenzene |
| Synonyms | Source |
|---|---|
| 3,4-dimethylstyrene | ChemIDplus |
| 4-vinyl-o-xylene | ChEBI |
| 1,2-dimethyl-4-vinylbenzene | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:27831-13-6 | ChemIDplus |
| CAS:27831-13-6 | NIST Chemistry WebBook |
| Citations |
|---|