EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H16ClN3OS |
| Net Charge | 0 |
| Average Mass | 393.899 |
| Monoisotopic Mass | 393.07026 |
| SMILES | Cc1ccc2oc(-c3cccc(NC(=S)Nc4ccc(Cl)cc4)c3)nc2c1 |
| InChI | InChI=1S/C21H16ClN3OS/c1-13-5-10-19-18(11-13)25-20(26-19)14-3-2-4-17(12-14)24-21(27)23-16-8-6-15(22)7-9-16/h2-12H,1H3,(H2,23,24,27) |
| InChIKey | ZMSAGNFQKUNPME-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 5.1.1.* (racemases acting on amino acids and derivatives) inhibitor An EC 5.1.* (racemase/epimerase) inhibitor that interferes with the function of any racemase acting on amino acids or their derivatives (EC 5.1.1.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(4-chlorophenyl)-3-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]thiourea (CHEBI:143827) has role EC 5.1.1.* (racemases acting on amino acids and derivatives) inhibitor (CHEBI:76828) |
| 1-(4-chlorophenyl)-3-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]thiourea (CHEBI:143827) is a 1,3-benzoxazoles (CHEBI:51548) |
| 1-(4-chlorophenyl)-3-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]thiourea (CHEBI:143827) is a monochlorobenzenes (CHEBI:83403) |
| 1-(4-chlorophenyl)-3-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]thiourea (CHEBI:143827) is a thioureas (CHEBI:51276) |
| IUPAC Names |
|---|
| 1-(4-chlorophenyl)-3-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]thiourea |
| N-(4-chlorophenyl)-N'-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]thiourea |
| Synonym | Source |
|---|---|
| 1-(4-chlorophenyl)-3-(3-(5-methylbenzo[d]oxazol-2-yl)phenyl)thiourea | ChEBI |
| Citations |
|---|