EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H17F2N5OS |
| Net Charge | 0 |
| Average Mass | 437.475 |
| Monoisotopic Mass | 437.11219 |
| SMILES | C[C@@H](c1nc(-c2ccc(C#N)cc2)cs1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H17F2N5OS/c1-14(21-28-20(10-31-21)16-4-2-15(9-25)3-5-16)22(30,11-29-13-26-12-27-29)18-7-6-17(23)8-19(18)24/h2-8,10,12-14,30H,11H2,1H3/t14-,22+/m0/s1 |
| InChIKey | OPAHEYNNJWPQPX-RCDICMHDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. EC 1.14.14.154 (sterol 14alpha-demethylase) inhibitor Any EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor that interferes with the action of sterol 14α-demethylase (EC 1.14.14.154). |
| Applications: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ravuconazole (CHEBI:143825) has role antifungal drug (CHEBI:86327) |
| ravuconazole (CHEBI:143825) has role antileishmanial agent (CHEBI:70868) |
| ravuconazole (CHEBI:143825) has role EC 1.14.14.154 (sterol 14α-demethylase) inhibitor (CHEBI:143828) |
| ravuconazole (CHEBI:143825) has role ergosterol biosynthesis inhibitor (CHEBI:75282) |
| ravuconazole (CHEBI:143825) is a 1,3-thiazoles (CHEBI:38418) |
| ravuconazole (CHEBI:143825) is a fluorobenzenes (CHEBI:35496) |
| ravuconazole (CHEBI:143825) is a nitrile (CHEBI:18379) |
| ravuconazole (CHEBI:143825) is a tertiary alcohol (CHEBI:26878) |
| ravuconazole (CHEBI:143825) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| 4-[2-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]-1,3-thiazol-4-yl]benzonitrile |
| INNs | Source |
|---|---|
| ravuconazol | WHO MedNet |
| ravuconazole | WHO MedNet |
| ravuconazole | WHO MedNet |
| ravuconazolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| BMS-20714 | ChEBI |
| BMS 207147 | ChemIDplus |
| ER 30346 | ChemIDplus |
| ER-30346 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D02556 | KEGG DRUG |
| DB06440 | DrugBank |
| HMDB0257114 | HMDB |
| Ravuconazole | Wikipedia |
| US2011087030 | Patent |
| WO2011042827 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:182760-06-1 | ChemIDplus |
| CAS:182760-06-1 | KEGG DRUG |
| Citations |
|---|