EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13NO4S |
| Net Charge | 0 |
| Average Mass | 219.262 |
| Monoisotopic Mass | 219.05653 |
| SMILES | C/C=C/S(=O)CC(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C8H13NO4S/c1-3-4-14(13)5-7(8(11)12)9-6(2)10/h3-4,7H,5H2,1-2H3,(H,9,10)(H,11,12)/b4-3+ |
| InChIKey | KTXJVMGVBKRPAP-ONEGZZNKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-S-(1Z)-propenyl-cysteine-sulfoxide (CHEBI:143824) is a N-acetyl-amino acid (CHEBI:21575) |
| N-acetyl-S-(1Z)-propenyl-cysteine-sulfoxide (CHEBI:143824) is a alanine derivative (CHEBI:22278) |
| N-acetyl-S-(1Z)-propenyl-cysteine-sulfoxide (CHEBI:143824) is a cysteine derivative (CHEBI:23509) |
| N-acetyl-S-(1Z)-propenyl-cysteine-sulfoxide (CHEBI:143824) is a olefinic compound (CHEBI:78840) |
| N-acetyl-S-(1Z)-propenyl-cysteine-sulfoxide (CHEBI:143824) is a sulfoxide (CHEBI:22063) |