EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O8 |
| Net Charge | 0 |
| Average Mass | 346.376 |
| Monoisotopic Mass | 346.16277 |
| SMILES | [H][C@]12C[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](C)[C@@]1([H])C(=O)OC[C@@H]2C |
| InChI | InChI=1S/C16H26O8/c1-6-5-22-15(21)11-7(2)9(3-8(6)11)23-16-14(20)13(19)12(18)10(4-17)24-16/h6-14,16-20H,3-5H2,1-2H3/t6-,7-,8+,9+,10+,11+,12+,13-,14+,16+/m0/s1 |
| InChIKey | CUIDBUWFCFYEPL-PIFFKTMJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nepeta cataria (ncbitaxon:39347) | aerial part (BTO:0001658) | DOI (10.1016/0031-9422(88)83122-4) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nepetaside (CHEBI:143821) has role plant metabolite (CHEBI:76924) |
| nepetaside (CHEBI:143821) is a iridoid monoterpenoid (CHEBI:50563) |
| nepetaside (CHEBI:143821) is a organic heterobicyclic compound (CHEBI:27171) |
| nepetaside (CHEBI:143821) is a terpene glycoside (CHEBI:61777) |
| nepetaside (CHEBI:143821) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (4R,4aR,6R,7R,7aS)-4,7-dimethyl-1-oxooctahydrocyclopenta[c]pyran-6-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| (−)-nepetaside | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00010642 | KNApSAcK |
| FDB017377 | FooDB |
| HMDB0038149 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:114076-56-1 | KNApSAcK |