EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H26N8 |
| Net Charge | 0 |
| Average Mass | 618.704 |
| Monoisotopic Mass | 618.22804 |
| SMILES | C1=Cc2nc1c(-c1ccncc1)c1nc(c(-c3ccncc3)c3ccc(n3)c(-c3ccncc3)c3ccc(n3)c2-c2ccncc2)C=C1 |
| InChI | InChI=1S/C40H26N8/c1-2-30-38(26-11-19-42-20-12-26)32-5-6-34(47-32)40(28-15-23-44-24-16-28)36-8-7-35(48-36)39(27-13-21-43-22-14-27)33-4-3-31(46-33)37(29(1)45-30)25-9-17-41-18-10-25/h1-24,45-46H/b37-29-,37-31-,38-30-,38-32-,39-33-,39-35-,40-34-,40-36- |
| InChIKey | WQCKXOJXOKSXQZ-XXDGMDECSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,10,15,20-tetra(4-pyridyl)-21H,23H-porphine (CHEBI:143769) is a meso-substituted porphyrin (CHEBI:52188) |
| 5,10,15,20-tetra(4-pyridyl)-21H,23H-porphine (CHEBI:143769) is a pyridines (CHEBI:26421) |
| Manual Xrefs | Databases |
|---|---|
| 77653 | ChemSpider |