EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O2 |
| Net Charge | 0 |
| Average Mass | 292.463 |
| Monoisotopic Mass | 292.24023 |
| SMILES | CC12CC[C@@H](O)C[C@H]1CCC1C2CCC2(C)C1CC[C@@H]2O |
| InChI | InChI=1S/C19H32O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-17,20-21H,3-11H2,1-2H3/t12-,13-,14?,15?,16?,17+,18?,19?/m1/s1 |
| InChIKey | CBMYJHIOYJEBSB-GCFMDFLISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bathymodiolus (ncbitaxon:12965) | gill filament (BTO:0002150) | MetaboLights (MTBLS746) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,5R,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol (CHEBI:143738) has role androgen (CHEBI:50113) |
| (3R,5R,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol (CHEBI:143738) is a 3-hydroxy steroid (CHEBI:36834) |