EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O3 |
| Net Charge | 0 |
| Average Mass | 178.187 |
| Monoisotopic Mass | 178.06299 |
| SMILES | COc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C10H10O3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-7H,1H3,(H,11,12)/b7-4+ |
| InChIKey | AFDXODALSZRGIH-QPJJXVBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bathymodiolus (ncbitaxon:12965) | gill filament (BTO:0002150) | MetaboLights (MTBLS746) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-3-(4-methoxyphenyl)prop-2-enoic acid (CHEBI:143736) is a cinnamic acids (CHEBI:23252) |
| IUPAC Name |
|---|
| (2E)-3-(4-methoxyphenyl)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| K3Z | PDBeChem |