EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20NO3 |
| Net Charge | -1 |
| Average Mass | 262.329 |
| Monoisotopic Mass | 262.14487 |
| SMILES | CCCCCCCC(=O)Nc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C15H21NO3/c1-2-3-4-5-6-11-14(17)16-13-10-8-7-9-12(13)15(18)19/h7-10H,2-6,11H2,1H3,(H,16,17)(H,18,19)/p-1 |
| InChIKey | DIBJPKPIMHBNDD-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-octanoylanthranilate (CHEBI:143722) has functional parent anthranilate (CHEBI:16567) |
| N-octanoylanthranilate (CHEBI:143722) has functional parent octanoic acid (CHEBI:28837) |
| N-octanoylanthranilate (CHEBI:143722) is a amidobenzoate (CHEBI:61666) |
| N-octanoylanthranilate (CHEBI:143722) is conjugate base of N-octanoylanthranilic acid (CHEBI:143902) |
| Incoming Relation(s) |
| N-octanoylanthranilic acid (CHEBI:143902) is conjugate acid of N-octanoylanthranilate (CHEBI:143722) |
| IUPAC Name |
|---|
| 2-(octanoylamino)benzoate |
| UniProt Name | Source |
|---|---|
| N-octanoylanthranilate | UniProt |
| Citations |
|---|