EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19N2O4 |
| Net Charge | -1 |
| Average Mass | 255.294 |
| Monoisotopic Mass | 255.13503 |
| SMILES | CCC/C(C)=C/C(=O)N[C@@H](CCC(N)=O)C(=O)[O-] |
| InChI | InChI=1S/C12H20N2O4/c1-3-4-8(2)7-11(16)14-9(12(17)18)5-6-10(13)15/h7,9H,3-6H2,1-2H3,(H2,13,15)(H,14,16)(H,17,18)/p-1/b8-7+/t9-/m0/s1 |
| InChIKey | AUBGCRXOZPJJJG-FLOXNTQESA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-[(2E)-3-methylhex-2-enoyl]-L-glutaminate (CHEBI:143557) is a N-(fatty acyl)-L-glutamine(1−) (CHEBI:149743) |
| N2-[(2E)-3-methylhex-2-enoyl]-L-glutaminate (CHEBI:143557) is a N2-acyl-L-glutaminate (CHEBI:87584) |
| N2-[(2E)-3-methylhex-2-enoyl]-L-glutaminate (CHEBI:143557) is conjugate base of N2-[(2E)-3-methylhex-2-enoyl]-L-glutamine (CHEBI:145321) |
| Incoming Relation(s) |
| N2-[(2E)-3-methylhex-2-enoyl]-L-glutamine (CHEBI:145321) is conjugate acid of N2-[(2E)-3-methylhex-2-enoyl]-L-glutaminate (CHEBI:143557) |
| IUPAC Name |
|---|
| N2-[(2E)-3-methylhex-2-enoyl]-L-glutaminate |
| UniProt Name | Source |
|---|---|
| N2-[(2E)-3-methylhex-2-enoyl]-L-glutaminate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-21074 | MetaCyc |
| Citations |
|---|