EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21N2O5 |
| Net Charge | -1 |
| Average Mass | 273.309 |
| Monoisotopic Mass | 273.14560 |
| SMILES | CCCC(C)(O)CC(=O)N[C@@H](CCC(N)=O)C(=O)[O-] |
| InChI | InChI=1S/C12H22N2O5/c1-3-6-12(2,19)7-10(16)14-8(11(17)18)4-5-9(13)15/h8,19H,3-7H2,1-2H3,(H2,13,15)(H,14,16)(H,17,18)/p-1/t8-,12?/m0/s1 |
| InChIKey | VICYTSBIRVLSRJ-KBPLZSHQSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-(3-hydroxy-3-methylhexanoyl)-L-glutaminate (CHEBI:143556) is a N-(fatty acyl)-L-glutamine(1−) (CHEBI:149743) |
| N2-(3-hydroxy-3-methylhexanoyl)-L-glutaminate (CHEBI:143556) is a N2-acyl-L-glutaminate (CHEBI:87584) |
| N2-(3-hydroxy-3-methylhexanoyl)-L-glutaminate (CHEBI:143556) is conjugate base of N2-(3-hydroxy-3-methylhexanoyl)-L-glutamine (CHEBI:145323) |
| Incoming Relation(s) |
| N2-(3-hydroxy-3-methylhexanoyl)-L-glutamine (CHEBI:145323) is conjugate acid of N2-(3-hydroxy-3-methylhexanoyl)-L-glutaminate (CHEBI:143556) |
| IUPAC Name |
|---|
| N2-(3-hydroxy-3-methylhexanoyl)-L-glutaminate |
| UniProt Name | Source |
|---|---|
| N2-(3-hydroxy-3-methylhexanoyl)-L-glutamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-21075 | MetaCyc |
| Citations |
|---|