EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C1CC[C@]2([C@@H](C)CCC=C(C)C)C[C@H]12 |
| InChI | InChI=1S/C15H24/c1-11(2)6-5-7-13(4)15-9-8-12(3)14(15)10-15/h6,13-14H,3,5,7-10H2,1-2,4H3/t13-,14+,15+/m0/s1 |
| InChIKey | DYUSFBWNOCHOFP-RRFJBIMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | - | PubMed (15075399) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sesquisabinene B (CHEBI:143550) has role plant metabolite (CHEBI:76924) |
| sesquisabinene B (CHEBI:143550) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1R,5R)-1-[(2S)-6-methylhept-5-en-2-yl]-4-methylidenebicyclo[3.1.0]hexane |
| UniProt Name | Source |
|---|---|
| sesquisabinene B | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-13872 | MetaCyc |
| Citations |
|---|