EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O5 |
| Net Charge | 0 |
| Average Mass | 148.114 |
| Monoisotopic Mass | 148.03717 |
| SMILES | COC(=O)C(O)CC(=O)O |
| InChI | InChI=1S/C5H8O5/c1-10-5(9)3(6)2-4(7)8/h3,6H,2H2,1H3,(H,7,8) |
| InChIKey | RTSODCRZYKSCLO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | flag leaf (BTO:0002811) | MetaboLights (MTBLS801) | Strain: Oryza sativa cv. N22 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methylester malic acid (CHEBI:143541) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| 1-methylester malic acid (CHEBI:143541) is a carboxylic ester (CHEBI:33308) |
| IUPAC Name |
|---|
| 3-hydroxy-4-methoxy-4-oxobutanoic acid |