EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6N2O3 |
| Net Charge | 0 |
| Average Mass | 130.103 |
| Monoisotopic Mass | 130.03784 |
| SMILES | O=C1NCC(C(=O)O)N1 |
| InChI | InChI=1S/C4H6N2O3/c7-3(8)2-1-5-4(9)6-2/h2H,1H2,(H,7,8)(H2,5,6,9) |
| InChIKey | KZKRPYCBSZIQKN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | flag leaf (BTO:0002811) | MetaboLights (MTBLS801) | Strain: Oryza sativa cv. N22 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Imidazolidone-4-carboxylic acid (CHEBI:143539) has functional parent α-amino acid (CHEBI:33704) |
| 2-Imidazolidone-4-carboxylic acid (CHEBI:143539) is a imidazolidinone (CHEBI:55370) |
| 2-Imidazolidone-4-carboxylic acid (CHEBI:143539) is a monocarboxylic acid (CHEBI:25384) |
| 2-Imidazolidone-4-carboxylic acid (CHEBI:143539) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 2-oxoimidazolidine-4-carboxylic acid |