EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20N4O3 |
| Net Charge | 0 |
| Average Mass | 280.328 |
| Monoisotopic Mass | 280.15354 |
| SMILES | C[C@@H](O)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C13H20N4O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8-9,18H,4-7H2,1-3H3/t9-/m1/s1 |
| InChIKey | NSMXQKNUPPXBRG-SECBINFHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-lisofylline (CHEBI:143527) has role anti-inflammatory agent (CHEBI:67079) |
| (R)-lisofylline (CHEBI:143527) has role immunomodulator (CHEBI:50846) |
| (R)-lisofylline (CHEBI:143527) is a 1-(5-hydroxyhexyl)-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione (CHEBI:143565) |
| (R)-lisofylline (CHEBI:143527) is enantiomer of (S)-lisofylline (CHEBI:143564) |
| Incoming Relation(s) |
| rac-lisofylline (CHEBI:143567) has part (R)-lisofylline (CHEBI:143527) |
| (S)-lisofylline (CHEBI:143564) is enantiomer of (R)-lisofylline (CHEBI:143527) |
| IUPAC Name |
|---|
| 1-[(5R)-5-hydroxyhexyl]-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione |
| INNs | Source |
|---|---|
| lisofilina | WHO MedNet |
| lisofylline | WHO MedNet |
| lisofylline | VSDB |
| lisofyllinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-[(5R)-5-hydroxyhexyl]-3,7-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione | DrugBank |
| 1-(5R-hydroxyhexyl)-3,7-dimethylxanthine | ChEBI |
| 1-[(R)-5-hydroxyhexyl]theobromine | ChEBI |
| CT 1501R | ChemIDplus |
| CT-1501R | ChEBI |
| (R)-1-(5-hydroxyhexyl)-3,7-dimethylxanthine | ChEBI |
| Brand Name | Source |
|---|---|
| ProTec | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D04748 | KEGG DRUG |
| DB12406 | DrugBank |
| Lisofylline | Wikipedia |
| WO2009099582 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:100324-81-0 | ChemIDplus |
| CAS:100324-81-0 | DrugBank |
| Citations |
|---|