EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19F2N3O6S |
| Net Charge | 0 |
| Average Mass | 419.406 |
| Monoisotopic Mass | 419.09626 |
| SMILES | COCc1cccc([C@H](O)c2nc(OC)cc(OC)n2)c1NS(=O)(=O)C(F)F |
| InChI | InChI=1S/C16H19F2N3O6S/c1-25-8-9-5-4-6-10(13(9)21-28(23,24)16(17)18)14(22)15-19-11(26-2)7-12(20-15)27-3/h4-7,14,16,21-22H,8H2,1-3H3/t14-/m0/s1 |
| InChIKey | NTBVTCXMRYKRTB-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Application: | pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-pyrimisulfan (CHEBI:143524) is a N-{2-[(4,6-dimethoxypyrimidin-2-yl)(hydroxy)methyl]-6-(methoxymethyl)phenyl}-1,1-difluoromethanesulfonamide (CHEBI:143522) |
| (S)-pyrimisulfan (CHEBI:143524) is enantiomer of (R)-pyrimisulfan (CHEBI:143523) |
| Incoming Relation(s) |
| pyrimisulfan (CHEBI:143521) has part (S)-pyrimisulfan (CHEBI:143524) |
| (R)-pyrimisulfan (CHEBI:143523) is enantiomer of (S)-pyrimisulfan (CHEBI:143524) |
| IUPAC Name |
|---|
| N-{2-[(S)-(4,6-dimethoxypyrimidin-2-yl)(hydroxy)methyl]-6-(methoxymethyl)phenyl}-1,1-difluoromethanesulfonamide |