EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H37NO4 |
| Net Charge | 0 |
| Average Mass | 391.552 |
| Monoisotopic Mass | 391.27226 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C23H37NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(26)24-21(20-25)23(27)28/h6-7,9-10,12-13,15-16,21,25H,2-5,8,11,14,17-20H2,1H3,(H,24,26)(H,27,28)/b7-6-,10-9-,13-12-,16-15-/t21-/m0/s1 |
| InChIKey | FQUVPTVNRMUOPO-UPQKDGGNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | brain (BTO:0000142) | PubMed (16467152) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. pro-angiogenic agent Any compound that promotes the growth of new blood vessels from pre-existing vessels. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-arachidonoyl-L-serine (CHEBI:143514) has functional parent L-serine (CHEBI:17115) |
| N-arachidonoyl-L-serine (CHEBI:143514) has functional parent arachidonic acid (CHEBI:15843) |
| N-arachidonoyl-L-serine (CHEBI:143514) has role cannabinoid receptor agonist (CHEBI:67072) |
| N-arachidonoyl-L-serine (CHEBI:143514) has role mammalian metabolite (CHEBI:75768) |
| N-arachidonoyl-L-serine (CHEBI:143514) has role neuroprotective agent (CHEBI:63726) |
| N-arachidonoyl-L-serine (CHEBI:143514) has role pro-angiogenic agent (CHEBI:72571) |
| N-arachidonoyl-L-serine (CHEBI:143514) has role vasodilator agent (CHEBI:35620) |
| N-arachidonoyl-L-serine (CHEBI:143514) is a N-(fatty acyl)-L-α-amino acid (CHEBI:137550) |
| N-arachidonoyl-L-serine (CHEBI:143514) is conjugate acid of N-arachidonoyl-L-serine(1−) (CHEBI:149697) |
| Incoming Relation(s) |
| N-arachidonoyl-L-serine(1−) (CHEBI:149697) is conjugate base of N-arachidonoyl-L-serine (CHEBI:143514) |
| IUPAC Name |
|---|
| N-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]-L-serine |
| Synonyms | Source |
|---|---|
| (2S)-3-hydroxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenamido]propanoic acid | ChEBI |
| (2S)-3-hydroxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoylamino]propanoic acid | ChEBI |
| ARA-S | SUBMITTER |
| C20:4(5Z,8Z,11Z,14Z)-L-Ser | ChEBI |
| N-[(5Z,8Z,11Z,14Z)-1-Oxo-5,8,11,14-icosatetraenyl]-L-serine | ChEBI |
| N-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-L-serine | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| LMFA08020073 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:187224-29-9 | SUBMITTER |
| Citations |
|---|