EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29FO2 |
| Net Charge | 0 |
| Average Mass | 320.448 |
| Monoisotopic Mass | 320.21516 |
| SMILES | CC12C=C[C@]3(F)C(CCC4CC(=O)CCC43C)C1CC[C@@]2(C)O |
| InChI | InChI=1S/C20H29FO2/c1-17-8-6-14(22)12-13(17)4-5-16-15-7-9-19(3,23)18(15,2)10-11-20(16,17)21/h10-11,13,15-16,23H,4-9,12H2,1-3H3/t13?,15?,16?,17?,18?,19-,20+/m1/s1 |
| InChIKey | MUHWBWWNVRTUFW-JYRXSWNASA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,9bR)-9b-fluoro-1-hydroxy-1,9a,11a-trimethyl-2H,3H,3aH,3bH,4H,5H,5aH,6H,8H,9H-cyclopenta[a]phenanthren-7-one (CHEBI:143504) has role androgen (CHEBI:50113) |
| (1S,9bR)-9b-fluoro-1-hydroxy-1,9a,11a-trimethyl-2H,3H,3aH,3bH,4H,5H,5aH,6H,8H,9H-cyclopenta[a]phenanthren-7-one (CHEBI:143504) is a 3-hydroxy steroid (CHEBI:36834) |