EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29FO3 |
| Net Charge | 0 |
| Average Mass | 336.447 |
| Monoisotopic Mass | 336.21007 |
| SMILES | CC1(C)CCC2=C1CC(O)[C@@]1(F)C2CC(O)C2CC(=O)CCC21C |
| InChI | InChI=1S/C20H29FO3/c1-18(2)6-5-12-13(18)10-17(24)20(21)14(12)9-16(23)15-8-11(22)4-7-19(15,20)3/h14-17,23-24H,4-10H2,1-3H3/t14?,15?,16?,17?,19?,20-/m0/s1 |
| InChIKey | RGWZWLSRQRQJRR-UMSBGXLASA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9bR)-9b-fluoro-5,10-dihydroxy-1,1,9a-trimethyl-2H,3H,3bH,4H,5H,5aH,6H,8H,9H,10H,11H-cyclopenta[a]phenanthren-7-one (CHEBI:143502) has role androgen (CHEBI:50113) |
| (9bR)-9b-fluoro-5,10-dihydroxy-1,1,9a-trimethyl-2H,3H,3bH,4H,5H,5aH,6H,8H,9H,10H,11H-cyclopenta[a]phenanthren-7-one (CHEBI:143502) is a 3-hydroxy steroid (CHEBI:36834) |