EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19NO4 |
| Net Charge | 0 |
| Average Mass | 289.331 |
| Monoisotopic Mass | 289.13141 |
| SMILES | CC[C@@]1(CC(=O)O)OCCc2c1nc1c(CO)cccc21 |
| InChI | InChI=1S/C16H19NO4/c1-2-16(8-13(19)20)15-12(6-7-21-16)11-5-3-4-10(9-18)14(11)17-15/h3-5,17-18H,2,6-9H2,1H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | HIEGNHLFLGNPQE-INIZCTEOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [1-ethyl-8-(hydroxymethyl)-3H,4H,9H-pyrano[3,4-b]indol-1-yl]acetic acid (CHEBI:143370) is a monocarboxylic acid (CHEBI:25384) |
| [1-ethyl-8-(hydroxymethyl)-3H,4H,9H-pyrano[3,4-b]indol-1-yl]acetic acid (CHEBI:143370) is a organic heterotricyclic compound (CHEBI:26979) |