EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11ClO3 |
| Net Charge | 0 |
| Average Mass | 214.648 |
| Monoisotopic Mass | 214.03967 |
| SMILES | O=C(O)C[C@@H](CO)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H11ClO3/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14/h1-4,8,12H,5-6H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | RTLXZWYTMZVUIO-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-3-(4-chlorophenyl)-4-hydroxybutanoic acid (CHEBI:143335) is a benzenes (CHEBI:22712) |
| (3S)-3-(4-chlorophenyl)-4-hydroxybutanoic acid (CHEBI:143335) is a monocarboxylic acid (CHEBI:25384) |