EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27N5O7 |
| Net Charge | 0 |
| Average Mass | 485.497 |
| Monoisotopic Mass | 485.19105 |
| SMILES | CC(C)(C#N)c1cc(Cn2cncn2)cc(C(C)(C#N)COC2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C23H27N5O7/c1-22(2,8-24)14-4-13(7-28-12-26-11-27-28)5-15(6-14)23(3,9-25)10-34-21-18(31)16(29)17(30)19(35-21)20(32)33/h4-6,11-12,16-19,21,29-31H,7,10H2,1-3H3,(H,32,33)/t16-,17-,18+,19-,21?,23?/m0/s1 |
| InChIKey | RCRSVHSRIMHUKO-JUVIALTQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,3S,4S,5R)-6-[2-cyano-2-[3-(2-cyanopropan-2-yl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]propoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (CHEBI:143329) is a cyanogenic glycoside (CHEBI:23436) |