EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31FO4 |
| Net Charge | 0 |
| Average Mass | 354.462 |
| Monoisotopic Mass | 354.22064 |
| SMILES | CC12CCC(=O)CC1C(O)CC1C3CC[C@](C)(O)C3(C)CC(O)[C@@]12F |
| InChI | InChI=1S/C20H31FO4/c1-17-6-4-11(22)8-14(17)15(23)9-13-12-5-7-19(3,25)18(12,2)10-16(24)20(13,17)21/h12-16,23-25H,4-10H2,1-3H3/t12?,13?,14?,15?,16?,17?,18?,19-,20-/m0/s1 |
| InChIKey | CJSJUVALVIEBEW-SPNMIUPVSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,9bR)-9b-fluoro-1,5,10-trihydroxy-1,9a,11a-trimethyl-dodecahydrocyclopenta[a]phenanthren-7-one (CHEBI:143322) has role androgen (CHEBI:50113) |
| (1S,9bR)-9b-fluoro-1,5,10-trihydroxy-1,9a,11a-trimethyl-dodecahydrocyclopenta[a]phenanthren-7-one (CHEBI:143322) is a 3-hydroxy steroid (CHEBI:36834) |