EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27FO4 |
| Net Charge | 0 |
| Average Mass | 350.430 |
| Monoisotopic Mass | 350.18934 |
| SMILES | CC12CC(=O)[C@]3(F)C(CC(O)C4=CC(=O)CCC43C)C1CC[C@@]2(C)O |
| InChI | InChI=1S/C20H27FO4/c1-17-6-4-11(22)8-14(17)15(23)9-13-12-5-7-19(3,25)18(12,2)10-16(24)20(13,17)21/h8,12-13,15,23,25H,4-7,9-10H2,1-3H3/t12?,13?,15?,17?,18?,19-,20-/m1/s1 |
| InChIKey | PSUUAYOYKHTGCF-PMGCRMHMSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,9bR)-9b-fluoro-1,5-dihydroxy-1,9a,11a-trimethyl-2H,3H,3aH,3bH,4H,5H,8H,9H,11H-cyclopenta[a]phenanthrene-7,10-dione (CHEBI:143321) has role androgen (CHEBI:50113) |
| (1S,9bR)-9b-fluoro-1,5-dihydroxy-1,9a,11a-trimethyl-2H,3H,3aH,3bH,4H,5H,8H,9H,11H-cyclopenta[a]phenanthrene-7,10-dione (CHEBI:143321) is a 3-hydroxy steroid (CHEBI:36834) |