EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27FO3 |
| Net Charge | 0 |
| Average Mass | 334.431 |
| Monoisotopic Mass | 334.19442 |
| SMILES | CC12CC(=O)[C@]3(F)C(CCC4=CC(=O)CCC43C)C1CC[C@@]2(C)O |
| InChI | InChI=1S/C20H27FO3/c1-17-8-6-13(22)10-12(17)4-5-15-14-7-9-19(3,24)18(14,2)11-16(23)20(15,17)21/h10,14-15,24H,4-9,11H2,1-3H3/t14?,15?,17?,18?,19-,20-/m1/s1 |
| InChIKey | YUMWOIMGKYOLOA-YQWJIGRCSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9R,17S)-9-fluoro-17-hydroxy-10,13,17-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione (CHEBI:143320) has role androgen (CHEBI:50113) |
| (9R,17S)-9-fluoro-17-hydroxy-10,13,17-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione (CHEBI:143320) is a 3-hydroxy steroid (CHEBI:36834) |