EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NO2 |
| Net Charge | 0 |
| Average Mass | 113.116 |
| Monoisotopic Mass | 113.04768 |
| SMILES | C#CC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H7NO2/c1-2-3-4(6)5(7)8/h1,4H,3,6H2,(H,7,8)/t4-/m0/s1 |
| InChIKey | DGYHPLMPMRKMPD-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-propargylglycine zwitterion (CHEBI:143285) has role antimicrobial agent (CHEBI:33281) |
| L-propargylglycine zwitterion (CHEBI:143285) is a L-α-amino acid zwitterion (CHEBI:59869) |
| L-propargylglycine zwitterion (CHEBI:143285) is tautomer of L-propargylglycine (CHEBI:43797) |
| Incoming Relation(s) |
| L-propargylglycine (CHEBI:43797) is tautomer of L-propargylglycine zwitterion (CHEBI:143285) |
| Synonym | Source |
|---|---|
| (2S)-2-aminopent-4-ynoate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| L-propargylglycine | UniProt |
| Citations |
|---|