EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:143265 - 8-aminooctanoic acid
| Formula | C8H17NO2 |
| Net Charge | 0 |
| Average Mass | 159.229 |
| Monoisotopic Mass | 159.12593 |
| SMILES | NCCCCCCCC(=O)O |
| InChI | InChI=1S/C8H17NO2/c9-7-5-3-1-2-4-6-8(10)11/h1-7,9H2,(H,10,11) |
| InChIKey | UQXNEWQGGVUVQA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (28439964) | Isolated from knee synovial fluid. |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-aminooctanoic acid (CHEBI:143265) has role human metabolite (CHEBI:77746) |
| 8-aminooctanoic acid (CHEBI:143265) is a medium-chain fatty acid (CHEBI:59554) |
| 8-aminooctanoic acid (CHEBI:143265) is a ω-amino fatty acid (CHEBI:59758) |
| IUPAC Name |
|---|
| 8-aminooctanoic acid |
| Synonyms | Source |
|---|---|
| 8-aminocaprylic acid | ChEBI |
| ChEBI | |
| ω-AC | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8AC | PDBeChem |
| LMFA01100059 | LIPID MAPS |
| Citations |
|---|