EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O2 |
| Net Charge | 0 |
| Average Mass | 400.647 |
| Monoisotopic Mass | 400.33413 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)C(=O)CCC(C)C |
| InChI | InChI=1S/C27H44O2/c1-17(2)6-11-25(29)18(3)22-9-10-23-21-8-7-19-16-20(28)12-14-26(19,4)24(21)13-15-27(22,23)5/h7,17-18,20-24,28H,6,8-16H2,1-5H3/t18-,20-,21-,22+,23-,24-,26-,27+/m0/s1 |
| InChIKey | ZJIBAMHOAQWYSE-CNXJXGGASA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.14.15.6 cholesterol monooxygenase (side-chain-cleaving) inhibitor Any EC 1.14.15.* (oxidoreductase acting on paired donors, with reduced Fe-S protein as one donor, incorporating 1 O atom) inhibitor that interferes with the action of cholesterol monooxygenase (side-chain-cleaving) (EC 1.14.15.6). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 22-ketocholesterol (CHEBI:143264) has role EC 1.14.15.6 cholesterol monooxygenase (side-chain-cleaving) inhibitor (CHEBI:144064) |
| 22-ketocholesterol (CHEBI:143264) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| 22-ketocholesterol (CHEBI:143264) is a 3β-sterol (CHEBI:35348) |
| 22-ketocholesterol (CHEBI:143264) is a cholestanoid (CHEBI:50401) |
| IUPAC Name |
|---|
| 3β-hydroxycholest-5-en-22-one |
| Synonyms | Source |
|---|---|
| (3β)-3-hydroxycholest-5-en-22-one | IUPAC |
| 22-oxocholesterol | ChemIDplus |
| 22-KetoC | ChEBI |
| 5-cholesten-3β-ol-22-one | ChEBI |
| 3β-hydroxy-5-cholestene-22-one | ChEBI |
| 22-ketocholesterol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:19243-30-2 | ChemIDplus |
| Citations |
|---|